C16H10Cl2F4N4 — CID 173488325
7-(2,4-dichlorophenyl)-6-fluoro-N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrido[2,3-b]pyrazin-8-amine (PubChem CID 173488325) has the molecular formula C16H10Cl2F4N4 and a molecular weight of 405.18 g/mol. Its IUPAC name is 7-(2,4-dichlorophenyl)-6-fluoro-N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrido[2,3-b]pyrazin-8-amine.
| Compound Name | 7-(2,4-dichlorophenyl)-6-fluoro-N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrido[2,3-b]pyrazin-8-amine |
|---|---|
| PubChem CID | 173488325 |
| Molecular Formula | C16H10Cl2F4N4 |
| Molecular Weight | 405.18 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 7-(2,4-dichlorophenyl)-6-fluoro-N-[(2R)-1,1,1-trifluoropropan-2-yl]pyrido[2,3-b]pyrazin-8-amine |
| SMILES | C[C@@H](Nc1c(-c2ccc(Cl)cc2Cl)c(F)nc2nccnc12)C(F)(F)F |
| InChI | InChI=1S/C16H10Cl2F4N4/c1-7(16(20,21)22)25-12-11(9-3-2-8(17)6-10(9)18)14(19)26-15-13(12)23-4-5-24-15/h2-7H,1H3,(H,24,25,26)/t7-/m1/s1 |
| InChIKey | HZFRQRBGULRXHK-SSDOTTSWSA-N |
| XLogP | 5.50 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.18 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|