C17H15Cl2FN4 — CID 59769248
N-butan-2-yl-6-chloro-7-(2-chloro-6-fluorophenyl)pyrido[2,3-b]pyrazin-8-amine (PubChem CID 59769248) has the molecular formula C17H15Cl2FN4 and a molecular weight of 365.24 g/mol. Its IUPAC name is N-butan-2-yl-6-chloro-7-(2-chloro-6-fluorophenyl)pyrido[2,3-b]pyrazin-8-amine.
| Compound Name | N-butan-2-yl-6-chloro-7-(2-chloro-6-fluorophenyl)pyrido[2,3-b]pyrazin-8-amine |
|---|---|
| PubChem CID | 59769248 |
| Molecular Formula | C17H15Cl2FN4 |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-butan-2-yl-6-chloro-7-(2-chloro-6-fluorophenyl)pyrido[2,3-b]pyrazin-8-amine |
| SMILES | CCC(C)Nc1c(-c2c(F)cccc2Cl)c(Cl)nc2nccnc12 |
| InChI | InChI=1S/C17H15Cl2FN4/c1-3-9(2)23-14-13(12-10(18)5-4-6-11(12)20)16(19)24-17-15(14)21-7-8-22-17/h4-9H,3H2,1-2H3,(H,22,23,24) |
| InChIKey | ZJJBMUOUOVVOAE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|