C14H16ClFN2O — CID 43335678
4-(2-chloro-6-fluorophenyl)-3-pentan-3-yl-1,2-oxazol-5-amine (PubChem CID 43335678) has the molecular formula C14H16ClFN2O and a molecular weight of 282.75 g/mol. Its IUPAC name is 4-(2-chloro-6-fluorophenyl)-3-pentan-3-yl-1,2-oxazol-5-amine.
| Compound Name | 4-(2-chloro-6-fluorophenyl)-3-pentan-3-yl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 43335678 |
| Molecular Formula | C14H16ClFN2O |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-(2-chloro-6-fluorophenyl)-3-pentan-3-yl-1,2-oxazol-5-amine |
| SMILES | CCC(CC)c1noc(N)c1-c1c(F)cccc1Cl |
| InChI | InChI=1S/C14H16ClFN2O/c1-3-8(4-2)13-12(14(17)19-18-13)11-9(15)6-5-7-10(11)16/h5-8H,3-4,17H2,1-2H3 |
| InChIKey | PCTAZFHAKAQLMT-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |