About 3-(2-chloro-6-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine
3-(2-chloro-6-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine (PubChem CID 62830824) has the molecular formula C16H12ClFN2O
and a molecular weight of 302.74 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine.
Molecular Properties
| Compound Name | 3-(2-chloro-6-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine |
| PubChem CID | 62830824 |
| Molecular Formula | C16H12ClFN2O |
| Molecular Weight | 302.74 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine |
| SMILES | Cc1cccc(-c2c(-c3c(F)cccc3Cl)noc2N)c1 |
| InChI | InChI=1S/C16H12ClFN2O/c1-9-4-2-5-10(8-9)13-15(20-21-16(13)19)14-11(17)6-3-7-12(14)18/h2-8H,19H2,1H3 |
| InChIKey | RBYONEBWOVHMEE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.74 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-chloro-6-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloro-6-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine?
The IUPAC name of 3-(2-chloro-6-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine (CID 62830824) is 3-(2-chloro-6-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine.
What is the SMILES notation for 3-(2-chloro-6-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine?
The canonical SMILES for 3-(2-chloro-6-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine is Cc1cccc(-c2c(-c3c(F)cccc3Cl)noc2N)c1.
What is the InChIKey of 3-(2-chloro-6-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine?
The InChIKey is RBYONEBWOVHMEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClFN2O/c1-9-4-2-5-10(8-9)13-15(20-21-16(13)19)14-11(17)6-3-7-12(14)18/h2-8H,19H2,1H3.
What are the key properties of 3-(2-chloro-6-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine?
3-(2-chloro-6-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine has a molecular weight of 302.74 g/mol, XLogP of 4.69, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloro-6-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine is sourced from PubChem (CID 62830824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).