C16H13FN2O — CID 62829957
3-(4-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine (PubChem CID 62829957) has the molecular formula C16H13FN2O and a molecular weight of 268.29 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(4-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 62829957 |
| Molecular Formula | C16H13FN2O |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-(4-fluorophenyl)-4-(3-methylphenyl)-1,2-oxazol-5-amine |
| SMILES | Cc1cccc(-c2c(-c3ccc(F)cc3)noc2N)c1 |
| InChI | InChI=1S/C16H13FN2O/c1-10-3-2-4-12(9-10)14-15(19-20-16(14)18)11-5-7-13(17)8-6-11/h2-9H,18H2,1H3 |
| InChIKey | STNAMBWLEOUAGT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |