C15H10FIN2O — CID 43336038
4-(3-fluorophenyl)-3-(4-iodophenyl)-1,2-oxazol-5-amine (PubChem CID 43336038) has the molecular formula C15H10FIN2O and a molecular weight of 380.16 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-3-(4-iodophenyl)-1,2-oxazol-5-amine.
| Compound Name | 4-(3-fluorophenyl)-3-(4-iodophenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 43336038 |
| Molecular Formula | C15H10FIN2O |
| Molecular Weight | 380.16 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 4-(3-fluorophenyl)-3-(4-iodophenyl)-1,2-oxazol-5-amine |
| SMILES | Nc1onc(-c2ccc(I)cc2)c1-c1cccc(F)c1 |
| InChI | InChI=1S/C15H10FIN2O/c16-11-3-1-2-10(8-11)13-14(19-20-15(13)18)9-4-6-12(17)7-5-9/h1-8H,18H2 |
| InChIKey | WFPQGYOEQTWAMB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.16 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|