C15H10F2N2O — CID 61496302
4-(3,5-difluorophenyl)-3-phenyl-1,2-oxazol-5-amine (PubChem CID 61496302) has the molecular formula C15H10F2N2O and a molecular weight of 272.25 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-3-phenyl-1,2-oxazol-5-amine.
| Compound Name | 4-(3,5-difluorophenyl)-3-phenyl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 61496302 |
| Molecular Formula | C15H10F2N2O |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 4-(3,5-difluorophenyl)-3-phenyl-1,2-oxazol-5-amine |
| SMILES | Nc1onc(-c2ccccc2)c1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H10F2N2O/c16-11-6-10(7-12(17)8-11)13-14(19-20-15(13)18)9-4-2-1-3-5-9/h1-8H,18H2 |
| InChIKey | GATKRGFYLNZCGI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |