C15H14F6N2O3 — CID 10156838
2-[4-[5-amino-3-(3-hydroxypropyl)-1,2-oxazol-4-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 10156838) has the molecular formula C15H14F6N2O3 and a molecular weight of 384.28 g/mol. Its IUPAC name is 2-[4-[5-amino-3-(3-hydroxypropyl)-1,2-oxazol-4-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[5-amino-3-(3-hydroxypropyl)-1,2-oxazol-4-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 10156838 |
| Molecular Formula | C15H14F6N2O3 |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2-[4-[5-amino-3-(3-hydroxypropyl)-1,2-oxazol-4-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1onc(CCCO)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H14F6N2O3/c16-14(17,18)13(25,15(19,20)21)9-5-3-8(4-6-9)11-10(2-1-7-24)23-26-12(11)22/h3-6,24-25H,1-2,7,22H2 |
| InChIKey | AHTWSIDYXQNGKR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |