C25H24F6N2O3 — CID 10164669
N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-propan-2-yl-1,2-oxazol-5-yl]-2-phenylbutanamide (PubChem CID 10164669) has the molecular formula C25H24F6N2O3 and a molecular weight of 514.47 g/mol. Its IUPAC name is N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-propan-2-yl-1,2-oxazol-5-yl]-2-phenylbutanamide.
| Compound Name | N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-propan-2-yl-1,2-oxazol-5-yl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 10164669 |
| Molecular Formula | C25H24F6N2O3 |
| Molecular Weight | 514.47 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-propan-2-yl-1,2-oxazol-5-yl]-2-phenylbutanamide |
| SMILES | CCC(C(=O)Nc1onc(C(C)C)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H24F6N2O3/c1-4-18(15-8-6-5-7-9-15)21(34)32-22-19(20(14(2)3)33-36-22)16-10-12-17(13-11-16)23(35,24(26,27)28)25(29,30)31/h5-14,18,35H,4H2,1-3H3,(H,32,34) |
| InChIKey | XBRLJCMSNZNYPV-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.47 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |