C21H17F6N3O3 — CID 10227245
N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-propan-2-yl-1,2-oxazol-5-yl]pyridine-4-carboxamide (PubChem CID 10227245) has the molecular formula C21H17F6N3O3 and a molecular weight of 473.37 g/mol. Its IUPAC name is N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-propan-2-yl-1,2-oxazol-5-yl]pyridine-4-carboxamide.
| Compound Name | N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-propan-2-yl-1,2-oxazol-5-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 10227245 |
| Molecular Formula | C21H17F6N3O3 |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | N-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-propan-2-yl-1,2-oxazol-5-yl]pyridine-4-carboxamide |
| SMILES | CC(C)c1noc(NC(=O)c2ccncc2)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H17F6N3O3/c1-11(2)16-15(18(33-30-16)29-17(31)13-7-9-28-10-8-13)12-3-5-14(6-4-12)19(32,20(22,23)24)21(25,26)27/h3-11,32H,1-2H3,(H,29,31) |
| InChIKey | PPAGOAJXHLSWPJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |