C17H11F6N3O2 — CID 10272495
2-[4-(5-amino-3-pyridin-4-yl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 10272495) has the molecular formula C17H11F6N3O2 and a molecular weight of 403.28 g/mol. Its IUPAC name is 2-[4-(5-amino-3-pyridin-4-yl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-(5-amino-3-pyridin-4-yl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 10272495 |
| Molecular Formula | C17H11F6N3O2 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-[4-(5-amino-3-pyridin-4-yl-1,2-oxazol-4-yl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Nc1onc(-c2ccncc2)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H11F6N3O2/c18-16(19,20)15(27,17(21,22)23)11-3-1-9(2-4-11)12-13(26-28-14(12)24)10-5-7-25-8-6-10/h1-8,27H,24H2 |
| InChIKey | INBHFJIACZSINN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |