C17H15F6NO3 — CID 10272000
1-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazol-3-yl]butan-1-one (PubChem CID 10272000) has the molecular formula C17H15F6NO3 and a molecular weight of 395.30 g/mol. Its IUPAC name is 1-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazol-3-yl]butan-1-one.
| Compound Name | 1-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazol-3-yl]butan-1-one |
|---|---|
| PubChem CID | 10272000 |
| Molecular Formula | C17H15F6NO3 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 1-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-5-methyl-1,2-oxazol-3-yl]butan-1-one |
| SMILES | CCCC(=O)c1noc(C)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F6NO3/c1-3-4-12(25)14-13(9(2)27-24-14)10-5-7-11(8-6-10)15(26,16(18,19)20)17(21,22)23/h5-8,26H,3-4H2,1-2H3 |
| InChIKey | GWTRCRLHSWPDGO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |