C15H13Cl2FN4 — CID 86612849
4-(butan-2-ylamino)-6-chloro-5-(2-chloro-6-fluorophenyl)pyrimidine-2-carbonitrile (PubChem CID 86612849) has the molecular formula C15H13Cl2FN4 and a molecular weight of 339.20 g/mol. Its IUPAC name is 4-(butan-2-ylamino)-6-chloro-5-(2-chloro-6-fluorophenyl)pyrimidine-2-carbonitrile.
| Compound Name | 4-(butan-2-ylamino)-6-chloro-5-(2-chloro-6-fluorophenyl)pyrimidine-2-carbonitrile |
|---|---|
| PubChem CID | 86612849 |
| Molecular Formula | C15H13Cl2FN4 |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 4-(butan-2-ylamino)-6-chloro-5-(2-chloro-6-fluorophenyl)pyrimidine-2-carbonitrile |
| SMILES | CCC(C)Nc1nc(C#N)nc(Cl)c1-c1c(F)cccc1Cl |
| InChI | InChI=1S/C15H13Cl2FN4/c1-3-8(2)20-15-13(14(17)21-11(7-19)22-15)12-9(16)5-4-6-10(12)18/h4-6,8H,3H2,1-2H3,(H,20,21,22) |
| InChIKey | MBSDPRFGHXLVDA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |