C12H14Cl2N2 — CID 61023871
2-(butan-2-ylamino)-2-(2,6-dichlorophenyl)acetonitrile (PubChem CID 61023871) has the molecular formula C12H14Cl2N2 and a molecular weight of 257.16 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-2-(2,6-dichlorophenyl)acetonitrile.
| Compound Name | 2-(butan-2-ylamino)-2-(2,6-dichlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 61023871 |
| Molecular Formula | C12H14Cl2N2 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 2-(butan-2-ylamino)-2-(2,6-dichlorophenyl)acetonitrile |
| SMILES | CCC(C)NC(C#N)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H14Cl2N2/c1-3-8(2)16-11(7-15)12-9(13)5-4-6-10(12)14/h4-6,8,11,16H,3H2,1-2H3 |
| InChIKey | MMNPOFBATZIEAV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |