C10H12BrClN2S — CID 102840398
2-(4-bromo-5-chlorothiophen-2-yl)-2-(butan-2-ylamino)acetonitrile (PubChem CID 102840398) has the molecular formula C10H12BrClN2S and a molecular weight of 307.64 g/mol. Its IUPAC name is 2-(4-bromo-5-chlorothiophen-2-yl)-2-(butan-2-ylamino)acetonitrile.
| Compound Name | 2-(4-bromo-5-chlorothiophen-2-yl)-2-(butan-2-ylamino)acetonitrile |
|---|---|
| PubChem CID | 102840398 |
| Molecular Formula | C10H12BrClN2S |
| Molecular Weight | 307.64 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 2-(4-bromo-5-chlorothiophen-2-yl)-2-(butan-2-ylamino)acetonitrile |
| SMILES | CCC(C)NC(C#N)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C10H12BrClN2S/c1-3-6(2)14-8(5-13)9-4-7(11)10(12)15-9/h4,6,8,14H,3H2,1-2H3 |
| InChIKey | MVJWHFMLTRMLPB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |