C10H18BrN5O2 — CID 173488347
tert-butyl N-[(Z)-1-amino-2-(1-bromoprop-2-enylideneamino)-2-hydrazinylethenyl]carbamate (PubChem CID 173488347) has the molecular formula C10H18BrN5O2 and a molecular weight of 320.19 g/mol. Its IUPAC name is tert-butyl N-[(Z)-1-amino-2-(1-bromoprop-2-enylideneamino)-2-hydrazinylethenyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-1-amino-2-(1-bromoprop-2-enylideneamino)-2-hydrazinylethenyl]carbamate |
|---|---|
| PubChem CID | 173488347 |
| Molecular Formula | C10H18BrN5O2 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | tert-butyl N-[(Z)-1-amino-2-(1-bromoprop-2-enylideneamino)-2-hydrazinylethenyl]carbamate |
| SMILES | C=CC(Br)=N/C(NN)=C(\N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H18BrN5O2/c1-5-6(11)14-8(16-13)7(12)15-9(17)18-10(2,3)4/h5,16H,1,12-13H2,2-4H3,(H,15,17)/b8-7-,14-6? |
| InChIKey | QXIQXVZEFKMUSY-HQNYQRGJSA-N |
| XLogP | 1.04 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|