C14H24N2O4S — CID 22747899
tert-butyl (NZ)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-prop-2-enylsulfanylmethylidene]carbamate (PubChem CID 22747899) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-prop-2-enylsulfanylmethylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-prop-2-enylsulfanylmethylidene]carbamate |
|---|---|
| PubChem CID | 22747899 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | tert-butyl (NZ)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-prop-2-enylsulfanylmethylidene]carbamate |
| SMILES | C=CCS/C(=N\C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N2O4S/c1-8-9-21-10(15-11(17)19-13(2,3)4)16-12(18)20-14(5,6)7/h8H,1,9H2,2-7H3,(H,15,16,17,18) |
| InChIKey | FKKFAUKIWMIFGM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|