C10H16N2O4S — CID 173224112
[N-[(2-methylpropan-2-yl)oxycarbonyl]-C-prop-2-enylsulfanylcarbonimidoyl]carbamic acid (PubChem CID 173224112) has the molecular formula C10H16N2O4S and a molecular weight of 260.31 g/mol. Its IUPAC name is [N-[(2-methylpropan-2-yl)oxycarbonyl]-C-prop-2-enylsulfanylcarbonimidoyl]carbamic acid.
| Compound Name | [N-[(2-methylpropan-2-yl)oxycarbonyl]-C-prop-2-enylsulfanylcarbonimidoyl]carbamic acid |
|---|---|
| PubChem CID | 173224112 |
| Molecular Formula | C10H16N2O4S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | [N-[(2-methylpropan-2-yl)oxycarbonyl]-C-prop-2-enylsulfanylcarbonimidoyl]carbamic acid |
| SMILES | C=CCSC(=NC(=O)OC(C)(C)C)NC(=O)O |
| InChI | InChI=1S/C10H16N2O4S/c1-5-6-17-7(11-8(13)14)12-9(15)16-10(2,3)4/h5H,1,6H2,2-4H3,(H,13,14)(H,11,12,15) |
| InChIKey | OQBOKHBZQXWYLU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|