C11H18N2O5PY- — CID 173489446
ethane;4-hydroxy-1-[(2R,4R,5R)-4-hydroxy-5-(phosphanyloxymethyl)oxolan-2-yl]pyrimidin-2-one;yttrium (PubChem CID 173489446) has the molecular formula C11H18N2O5PY- and a molecular weight of 378.15 g/mol. Its IUPAC name is ethane;4-hydroxy-1-[(2R,4R,5R)-4-hydroxy-5-(phosphanyloxymethyl)oxolan-2-yl]pyrimidin-2-one;yttrium.
| Compound Name | ethane;4-hydroxy-1-[(2R,4R,5R)-4-hydroxy-5-(phosphanyloxymethyl)oxolan-2-yl]pyrimidin-2-one;yttrium |
|---|---|
| PubChem CID | 173489446 |
| Molecular Formula | C11H18N2O5PY- |
| Molecular Weight | 378.15 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | ethane;4-hydroxy-1-[(2R,4R,5R)-4-hydroxy-5-(phosphanyloxymethyl)oxolan-2-yl]pyrimidin-2-one;yttrium |
| SMILES | O=c1nc(O)ccn1[C@H]1C[C@@H](O)[C@@H](COP)O1.[CH2-]C.[Y] |
| InChI | InChI=1S/C9H13N2O5P.C2H5.Y/c12-5-3-8(16-6(5)4-15-17)11-2-1-7(13)10-9(11)14;1-2;/h1-2,5-6,8,12H,3-4,17H2,(H,10,13,14);1H2,2H3;/q;-1;/t5-,6-,8-;;/m1../s1 |
| InChIKey | XYZODJPAZQEJBR-WIXFYVQFSA-N |
| XLogP | 0.24 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.15 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|