C23H27N3O4 — CID 173494489
[3-(6-formyl-3,3-dimethyl-2,4-dihydro-1H-quinolin-2-yl)-5-morpholin-4-ylphenyl] carbamate (PubChem CID 173494489) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is [3-(6-formyl-3,3-dimethyl-2,4-dihydro-1H-quinolin-2-yl)-5-morpholin-4-ylphenyl] carbamate.
| Compound Name | [3-(6-formyl-3,3-dimethyl-2,4-dihydro-1H-quinolin-2-yl)-5-morpholin-4-ylphenyl] carbamate |
|---|---|
| PubChem CID | 173494489 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | [3-(6-formyl-3,3-dimethyl-2,4-dihydro-1H-quinolin-2-yl)-5-morpholin-4-ylphenyl] carbamate |
| SMILES | CC1(C)Cc2cc(C=O)ccc2NC1c1cc(OC(N)=O)cc(N2CCOCC2)c1 |
| InChI | InChI=1S/C23H27N3O4/c1-23(2)13-17-9-15(14-27)3-4-20(17)25-21(23)16-10-18(26-5-7-29-8-6-26)12-19(11-16)30-22(24)28/h3-4,9-12,14,21,25H,5-8,13H2,1-2H3,(H2,24,28) |
| InChIKey | UARCPAKYGFMPAW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|