C15H16ClN5 — CID 173495295
3-[(4-chlorophenyl)methylamino]-N'-(methyldiazenyl)benzenecarboximidamide (PubChem CID 173495295) has the molecular formula C15H16ClN5 and a molecular weight of 301.78 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methylamino]-N'-(methyldiazenyl)benzenecarboximidamide.
| Compound Name | 3-[(4-chlorophenyl)methylamino]-N'-(methyldiazenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 173495295 |
| Molecular Formula | C15H16ClN5 |
| Molecular Weight | 301.78 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 3-[(4-chlorophenyl)methylamino]-N'-(methyldiazenyl)benzenecarboximidamide |
| SMILES | C/N=N/N=C(N)c1cccc(NCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C15H16ClN5/c1-18-21-20-15(17)12-3-2-4-14(9-12)19-10-11-5-7-13(16)8-6-11/h2-9,19H,10H2,1H3,(H2,17,18,20) |
| InChIKey | PAUMDIOGWLIQDO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.78 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|