C12H16N2O — CID 173495989
N-methanimidoyl-2-phenylpentanamide (PubChem CID 173495989) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N-methanimidoyl-2-phenylpentanamide.
| Compound Name | N-methanimidoyl-2-phenylpentanamide |
|---|---|
| PubChem CID | 173495989 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N-methanimidoyl-2-phenylpentanamide |
| SMILES | [H]/N=C/NC(=O)C(CCC)c1ccccc1 |
| InChI | InChI=1S/C12H16N2O/c1-2-6-11(12(15)14-9-13)10-7-4-3-5-8-10/h3-5,7-9,11H,2,6H2,1H3,(H2,13,14,15) |
| InChIKey | FJYHWEMKNSQACV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|