C31H38N4O4 — CID 173496535
propan-2-yl N-[4-[3-(1-amino-3-methyliminoprop-1-enyl)-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl]carbamate (PubChem CID 173496535) has the molecular formula C31H38N4O4 and a molecular weight of 530.67 g/mol. Its IUPAC name is propan-2-yl N-[4-[3-(1-amino-3-methyliminoprop-1-enyl)-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl]carbamate.
| Compound Name | propan-2-yl N-[4-[3-(1-amino-3-methyliminoprop-1-enyl)-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 173496535 |
| Molecular Formula | C31H38N4O4 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | propan-2-yl N-[4-[3-(1-amino-3-methyliminoprop-1-enyl)-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl]carbamate |
| SMILES | C/N=C/C=C(N)c1c(-c2ccc(NC(=O)OC(C)C)cc2)n(C2CCC2)c2cc(OC3CCOCC3)ccc12 |
| InChI | InChI=1S/C31H38N4O4/c1-20(2)38-31(36)34-22-9-7-21(8-10-22)30-29(27(32)13-16-33-3)26-12-11-25(39-24-14-17-37-18-15-24)19-28(26)35(30)23-5-4-6-23/h7-13,16,19-20,23-24H,4-6,14-15,17-18,32H2,1-3H3,(H,34,36)/b27-13?,33-16+ |
| InChIKey | BIKUPNLGASPVGY-HRCUGFLUSA-N |
| XLogP | 6.55 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|