C32H35FN4O6 — CID 173496733
N-[3-[1-amino-4-[(3,4-dimethoxyphenyl)methyl-methylamino]-3,4-dioxobut-1-enyl]-4-methylphenyl]-3-fluoro-5-morpholin-4-ylbenzamide (PubChem CID 173496733) has the molecular formula C32H35FN4O6 and a molecular weight of 590.65 g/mol. Its IUPAC name is N-[3-[1-amino-4-[(3,4-dimethoxyphenyl)methyl-methylamino]-3,4-dioxobut-1-enyl]-4-methylphenyl]-3-fluoro-5-morpholin-4-ylbenzamide.
| Compound Name | N-[3-[1-amino-4-[(3,4-dimethoxyphenyl)methyl-methylamino]-3,4-dioxobut-1-enyl]-4-methylphenyl]-3-fluoro-5-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 173496733 |
| Molecular Formula | C32H35FN4O6 |
| Molecular Weight | 590.65 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | N-[3-[1-amino-4-[(3,4-dimethoxyphenyl)methyl-methylamino]-3,4-dioxobut-1-enyl]-4-methylphenyl]-3-fluoro-5-morpholin-4-ylbenzamide |
| SMILES | COc1ccc(CN(C)C(=O)C(=O)C=C(N)c2cc(NC(=O)c3cc(F)cc(N4CCOCC4)c3)ccc2C)cc1OC |
| InChI | InChI=1S/C32H35FN4O6/c1-20-5-7-24(35-31(39)22-14-23(33)16-25(15-22)37-9-11-43-12-10-37)17-26(20)27(34)18-28(38)32(40)36(2)19-21-6-8-29(41-3)30(13-21)42-4/h5-8,13-18H,9-12,19,34H2,1-4H3,(H,35,39) |
| InChIKey | GHUAQXNVIBSSID-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 123.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|