C27H23F4N7O2 — CID 173497232
N-[6-[[(5E,7E)-4-amino-8-(ethylideneamino)-1,1,1-trifluoro-8-methoxyocta-3,5,7-trien-2-ylidene]amino]pyridazin-3-yl]-3-(6-fluoro-3-pyridinyl)benzamide (PubChem CID 173497232) has the molecular formula C27H23F4N7O2 and a molecular weight of 553.52 g/mol. Its IUPAC name is N-[6-[[(5E,7E)-4-amino-8-(ethylideneamino)-1,1,1-trifluoro-8-methoxyocta-3,5,7-trien-2-ylidene]amino]pyridazin-3-yl]-3-(6-fluoro-3-pyridinyl)benzamide.
| Compound Name | N-[6-[[(5E,7E)-4-amino-8-(ethylideneamino)-1,1,1-trifluoro-8-methoxyocta-3,5,7-trien-2-ylidene]amino]pyridazin-3-yl]-3-(6-fluoro-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 173497232 |
| Molecular Formula | C27H23F4N7O2 |
| Molecular Weight | 553.52 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | N-[6-[[(5E,7E)-4-amino-8-(ethylideneamino)-1,1,1-trifluoro-8-methoxyocta-3,5,7-trien-2-ylidene]amino]pyridazin-3-yl]-3-(6-fluoro-3-pyridinyl)benzamide |
| SMILES | CC=N/C(=C\C=C\C(N)=C/C(=N\c1ccc(NC(=O)c2cccc(-c3ccc(F)nc3)c2)nn1)C(F)(F)F)OC |
| InChI | InChI=1S/C27H23F4N7O2/c1-3-33-25(40-2)9-5-8-20(32)15-21(27(29,30)31)35-23-12-13-24(38-37-23)36-26(39)18-7-4-6-17(14-18)19-10-11-22(28)34-16-19/h3-16H,32H2,1-2H3,(H,36,38,39)/b8-5+,20-15?,25-9+,33-3?,35-21+ |
| InChIKey | MUDYPMYINLHEET-REBIWRDASA-N |
| XLogP | 5.54 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|