C24H22F3N7O2 — CID 173497181
N-[6-[(4-amino-1,1,1-trifluoro-4-pyridin-3-ylbut-3-en-2-ylidene)amino]pyridazin-3-yl]-3-morpholin-4-ylbenzamide (PubChem CID 173497181) has the molecular formula C24H22F3N7O2 and a molecular weight of 497.48 g/mol. Its IUPAC name is N-[6-[(4-amino-1,1,1-trifluoro-4-pyridin-3-ylbut-3-en-2-ylidene)amino]pyridazin-3-yl]-3-morpholin-4-ylbenzamide.
| Compound Name | N-[6-[(4-amino-1,1,1-trifluoro-4-pyridin-3-ylbut-3-en-2-ylidene)amino]pyridazin-3-yl]-3-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 173497181 |
| Molecular Formula | C24H22F3N7O2 |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-[6-[(4-amino-1,1,1-trifluoro-4-pyridin-3-ylbut-3-en-2-ylidene)amino]pyridazin-3-yl]-3-morpholin-4-ylbenzamide |
| SMILES | NC(=C/C(=N\c1ccc(NC(=O)c2cccc(N3CCOCC3)c2)nn1)C(F)(F)F)c1cccnc1 |
| InChI | InChI=1S/C24H22F3N7O2/c25-24(26,27)20(14-19(28)17-4-2-8-29-15-17)30-21-6-7-22(33-32-21)31-23(35)16-3-1-5-18(13-16)34-9-11-36-12-10-34/h1-8,13-15H,9-12,28H2,(H,31,33,35)/b19-14?,30-20+ |
| InChIKey | YWOBJNWVPXRZNK-IBQYZROOSA-N |
| XLogP | 3.60 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|