C27H30N6O2S — CID 173497923
5-[2-[4-[(Z)-1-methyliminobut-2-en-2-yl]phenyl]ethenyl]-N-(4-piperazin-1-ylsulfonylphenyl)pyrimidin-2-amine (PubChem CID 173497923) has the molecular formula C27H30N6O2S and a molecular weight of 502.64 g/mol. Its IUPAC name is 5-[2-[4-[(Z)-1-methyliminobut-2-en-2-yl]phenyl]ethenyl]-N-(4-piperazin-1-ylsulfonylphenyl)pyrimidin-2-amine.
| Compound Name | 5-[2-[4-[(Z)-1-methyliminobut-2-en-2-yl]phenyl]ethenyl]-N-(4-piperazin-1-ylsulfonylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 173497923 |
| Molecular Formula | C27H30N6O2S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 5-[2-[4-[(Z)-1-methyliminobut-2-en-2-yl]phenyl]ethenyl]-N-(4-piperazin-1-ylsulfonylphenyl)pyrimidin-2-amine |
| SMILES | C/C=C(\C=N\C)c1ccc(C=Cc2cnc(Nc3ccc(S(=O)(=O)N4CCNCC4)cc3)nc2)cc1 |
| InChI | InChI=1S/C27H30N6O2S/c1-3-23(20-28-2)24-8-6-21(7-9-24)4-5-22-18-30-27(31-19-22)32-25-10-12-26(13-11-25)36(34,35)33-16-14-29-15-17-33/h3-13,18-20,29H,14-17H2,1-2H3,(H,30,31,32)/b5-4?,23-3+,28-20+ |
| InChIKey | RBUQGKCWBAHMJA-GJVCESNCSA-N |
| XLogP | 4.09 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|