C23H25ClN8O2S — CID 89362252
5-[(E)-2-(3-amino-5-chloro-2-diazenylphenyl)ethenyl]-N-[4-(1,4-diazepan-1-ylsulfonyl)phenyl]pyrimidin-2-amine (PubChem CID 89362252) has the molecular formula C23H25ClN8O2S and a molecular weight of 513.03 g/mol. Its IUPAC name is 5-[(E)-2-(3-amino-5-chloro-2-diazenylphenyl)ethenyl]-N-[4-(1,4-diazepan-1-ylsulfonyl)phenyl]pyrimidin-2-amine.
| Compound Name | 5-[(E)-2-(3-amino-5-chloro-2-diazenylphenyl)ethenyl]-N-[4-(1,4-diazepan-1-ylsulfonyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 89362252 |
| Molecular Formula | C23H25ClN8O2S |
| Molecular Weight | 513.03 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 5-[(E)-2-(3-amino-5-chloro-2-diazenylphenyl)ethenyl]-N-[4-(1,4-diazepan-1-ylsulfonyl)phenyl]pyrimidin-2-amine |
| SMILES | [H]/N=N/c1c(N)cc(Cl)cc1/C=C/c1cnc(Nc2ccc(S(=O)(=O)N3CCCNCC3)cc2)nc1 |
| InChI | InChI=1S/C23H25ClN8O2S/c24-18-12-17(22(31-26)21(25)13-18)3-2-16-14-28-23(29-15-16)30-19-4-6-20(7-5-19)35(33,34)32-10-1-8-27-9-11-32/h2-7,12-15,26-27H,1,8-11,25H2,(H,28,29,30)/b3-2+,31-26+ |
| InChIKey | HMCJTZFCCOTKGH-BERRIRIUSA-N |
| XLogP | 4.27 |
| TPSA | 149.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.03 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|