C16H30F3N3O2 — CID 173504414
Methyl 2-[2,6-dimethyl-4-[5-(2,2,2-trifluoroethylamino)pentyl]piperazin-1-yl]acetate (PubChem CID 173504414) has the molecular formula C16H30F3N3O2 and a molecular weight of 353.42 g/mol. Its IUPAC name is methyl 2-[2,6-dimethyl-4-[5-(2,2,2-trifluoroethylamino)pentyl]piperazin-1-yl]acetate.
| Compound Name | Methyl 2-[2,6-dimethyl-4-[5-(2,2,2-trifluoroethylamino)pentyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 173504414 |
| Molecular Formula | C16H30F3N3O2 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | methyl 2-[2,6-dimethyl-4-[5-(2,2,2-trifluoroethylamino)pentyl]piperazin-1-yl]acetate |
| SMILES | CC1CN(CC(N1CC(=O)OC)C)CCCCCNCC(F)(F)F |
| InChI | InChI=1S/C16H30F3N3O2/c1-13-9-21(10-14(2)22(13)11-15(23)24-3)8-6-4-5-7-20-12-16(17,18)19/h13-14,20H,4-12H2,1-3H3 |
| InChIKey | RKVKDGRKNXXQSN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | 368 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|