C19H21ClN2O5 — CID 17353570
N'-[2-(4-chloro-3-methylphenoxy)acetyl]-4-(2-methoxyethoxy)benzohydrazide (PubChem CID 17353570) has the molecular formula C19H21ClN2O5 and a molecular weight of 392.84 g/mol. Its IUPAC name is N'-[2-(4-chloro-3-methylphenoxy)acetyl]-4-(2-methoxyethoxy)benzohydrazide.
| Compound Name | N'-[2-(4-chloro-3-methylphenoxy)acetyl]-4-(2-methoxyethoxy)benzohydrazide |
|---|---|
| PubChem CID | 17353570 |
| Molecular Formula | C19H21ClN2O5 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N'-[2-(4-chloro-3-methylphenoxy)acetyl]-4-(2-methoxyethoxy)benzohydrazide |
| SMILES | COCCOc1ccc(C(=O)NNC(=O)COc2ccc(Cl)c(C)c2)cc1 |
| InChI | InChI=1S/C19H21ClN2O5/c1-13-11-16(7-8-17(13)20)27-12-18(23)21-22-19(24)14-3-5-15(6-4-14)26-10-9-25-2/h3-8,11H,9-10,12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | ZFNFNKSBONKAFZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|