C18H16ClN3O7 — CID 18209878
methyl 3-[[[2-(4-chloro-3-methylphenoxy)acetyl]amino]carbamoyl]-5-nitrobenzoate (PubChem CID 18209878) has the molecular formula C18H16ClN3O7 and a molecular weight of 421.79 g/mol. Its IUPAC name is methyl 3-[[[2-(4-chloro-3-methylphenoxy)acetyl]amino]carbamoyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[[[2-(4-chloro-3-methylphenoxy)acetyl]amino]carbamoyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 18209878 |
| Molecular Formula | C18H16ClN3O7 |
| Molecular Weight | 421.79 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | methyl 3-[[[2-(4-chloro-3-methylphenoxy)acetyl]amino]carbamoyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)NNC(=O)COc2ccc(Cl)c(C)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16ClN3O7/c1-10-5-14(3-4-15(10)19)29-9-16(23)20-21-17(24)11-6-12(18(25)28-2)8-13(7-11)22(26)27/h3-8H,9H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | OZVPJXUBJBZHED-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.79 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|