About 1-methylpyrazol-4-amine;hydrochloride
1-methylpyrazol-4-amine;hydrochloride (PubChem CID 17354268) has the molecular formula C4H8ClN3
and a molecular weight of 133.58 g/mol. Its IUPAC name is 1-methylpyrazol-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-methylpyrazol-4-amine;hydrochloride |
| PubChem CID | 17354268 |
| Molecular Formula | C4H8ClN3 |
| Molecular Weight | 133.58 g/mol |
| Exact Mass | 133.04 |
| IUPAC Name | 1-methylpyrazol-4-amine;hydrochloride |
| SMILES | Cl.Cn1cc(N)cn1 |
| InChI | InChI=1S/C4H7N3.ClH/c1-7-3-4(5)2-6-7;/h2-3H,5H2,1H3;1H |
| InChIKey | OKPCAONVUKBJJQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.58 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylpyrazol-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrazol-4-amine;hydrochloride?
The IUPAC name of 1-methylpyrazol-4-amine;hydrochloride (CID 17354268) is 1-methylpyrazol-4-amine;hydrochloride.
What is the SMILES notation for 1-methylpyrazol-4-amine;hydrochloride?
The canonical SMILES for 1-methylpyrazol-4-amine;hydrochloride is Cl.Cn1cc(N)cn1.
What is the InChIKey of 1-methylpyrazol-4-amine;hydrochloride?
The InChIKey is OKPCAONVUKBJJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3.ClH/c1-7-3-4(5)2-6-7;/h2-3H,5H2,1H3;1H.
What are the key properties of 1-methylpyrazol-4-amine;hydrochloride?
1-methylpyrazol-4-amine;hydrochloride has a molecular weight of 133.58 g/mol, XLogP of 0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrazol-4-amine;hydrochloride is sourced from PubChem (CID 17354268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).