C25H22N2O5 — CID 17358807
2-(2,5-dimethylphenoxy)-N-[4-(1,3-dioxoisoindol-5-yl)oxyphenyl]propanamide (PubChem CID 17358807) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N-[4-(1,3-dioxoisoindol-5-yl)oxyphenyl]propanamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N-[4-(1,3-dioxoisoindol-5-yl)oxyphenyl]propanamide |
|---|---|
| PubChem CID | 17358807 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N-[4-(1,3-dioxoisoindol-5-yl)oxyphenyl]propanamide |
| SMILES | Cc1ccc(C)c(OC(C)C(=O)Nc2ccc(Oc3ccc4c(c3)C(=O)NC4=O)cc2)c1 |
| InChI | InChI=1S/C25H22N2O5/c1-14-4-5-15(2)22(12-14)31-16(3)23(28)26-17-6-8-18(9-7-17)32-19-10-11-20-21(13-19)25(30)27-24(20)29/h4-13,16H,1-3H3,(H,26,28)(H,27,29,30) |
| InChIKey | JDBMQQRPXSCFSP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|