C18H18N4O3S3 — CID 17375029
1-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-3-(2,5-dimethoxyphenyl)thiourea (PubChem CID 17375029) has the molecular formula C18H18N4O3S3 and a molecular weight of 434.57 g/mol. Its IUPAC name is 1-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-3-(2,5-dimethoxyphenyl)thiourea.
| Compound Name | 1-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-3-(2,5-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17375029 |
| Molecular Formula | C18H18N4O3S3 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 1-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-3-(2,5-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(OC)c(NC(=S)NNC(=O)CSc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C18H18N4O3S3/c1-24-11-7-8-14(25-2)13(9-11)19-17(26)22-21-16(23)10-27-18-20-12-5-3-4-6-15(12)28-18/h3-9H,10H2,1-2H3,(H,21,23)(H2,19,22,26) |
| InChIKey | KKBKODQFOBRLGW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|