C23H22FNO5S — CID 17378233
3-[[4-(4-fluorophenyl)-3-propoxycarbonylthiophen-2-yl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 17378233) has the molecular formula C23H22FNO5S and a molecular weight of 443.50 g/mol. Its IUPAC name is 3-[[4-(4-fluorophenyl)-3-propoxycarbonylthiophen-2-yl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-[[4-(4-fluorophenyl)-3-propoxycarbonylthiophen-2-yl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 17378233 |
| Molecular Formula | C23H22FNO5S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 3-[[4-(4-fluorophenyl)-3-propoxycarbonylthiophen-2-yl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CCCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)C1C2C=CC(C2)C1C(=O)O |
| InChI | InChI=1S/C23H22FNO5S/c1-2-9-30-23(29)19-16(12-5-7-15(24)8-6-12)11-31-21(19)25-20(26)17-13-3-4-14(10-13)18(17)22(27)28/h3-8,11,13-14,17-18H,2,9-10H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | SYCWZYNGUUMWOW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|