C21H16ClFN4O — CID 17380821
1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-naphthalen-1-ylurea (PubChem CID 17380821) has the molecular formula C21H16ClFN4O and a molecular weight of 394.84 g/mol. Its IUPAC name is 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-naphthalen-1-ylurea.
| Compound Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-naphthalen-1-ylurea |
|---|---|
| PubChem CID | 17380821 |
| Molecular Formula | C21H16ClFN4O |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]pyrazol-3-yl]-3-naphthalen-1-ylurea |
| SMILES | O=C(Nc1ccn(Cc2c(F)cccc2Cl)n1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C21H16ClFN4O/c22-17-8-4-9-18(23)16(17)13-27-12-11-20(26-27)25-21(28)24-19-10-3-6-14-5-1-2-7-15(14)19/h1-12H,13H2,(H2,24,25,26,28) |
| InChIKey | BLWWWXABANVRPI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |