C23H24N4S3 — CID 17383129
4-[[4-ethyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-(3-methylphenyl)-1,3-thiazole (PubChem CID 17383129) has the molecular formula C23H24N4S3 and a molecular weight of 452.67 g/mol. Its IUPAC name is 4-[[4-ethyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-(3-methylphenyl)-1,3-thiazole.
| Compound Name | 4-[[4-ethyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-(3-methylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 17383129 |
| Molecular Formula | C23H24N4S3 |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 4-[[4-ethyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-3-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]-2-(3-methylphenyl)-1,3-thiazole |
| SMILES | CCn1c(SCc2csc(-c3cccc(C)c3)n2)nnc1-c1csc2c1CCCC2 |
| InChI | InChI=1S/C23H24N4S3/c1-3-27-21(19-14-28-20-10-5-4-9-18(19)20)25-26-23(27)30-13-17-12-29-22(24-17)16-8-6-7-15(2)11-16/h6-8,11-12,14H,3-5,9-10,13H2,1-2H3 |
| InChIKey | KKKUTIGUNUGPPT-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |