C23H24N4S3 — CID 28924783
4-[[4-methyl-5-[(6S)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]-1,2,4-triazol-3-yl]sulfanylmethyl]-2-(3-methylphenyl)-1,3-thiazole (PubChem CID 28924783) has the molecular formula C23H24N4S3 and a molecular weight of 452.67 g/mol. Its IUPAC name is 4-[[4-methyl-5-[(6S)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]-1,2,4-triazol-3-yl]sulfanylmethyl]-2-(3-methylphenyl)-1,3-thiazole.
| Compound Name | 4-[[4-methyl-5-[(6S)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]-1,2,4-triazol-3-yl]sulfanylmethyl]-2-(3-methylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 28924783 |
| Molecular Formula | C23H24N4S3 |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 4-[[4-methyl-5-[(6S)-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-3-yl]-1,2,4-triazol-3-yl]sulfanylmethyl]-2-(3-methylphenyl)-1,3-thiazole |
| SMILES | Cc1cccc(-c2nc(CSc3nnc(-c4csc5c4CC[C@H](C)C5)n3C)cs2)c1 |
| InChI | InChI=1S/C23H24N4S3/c1-14-5-4-6-16(9-14)22-24-17(11-29-22)12-30-23-26-25-21(27(23)3)19-13-28-20-10-15(2)7-8-18(19)20/h4-6,9,11,13,15H,7-8,10,12H2,1-3H3/t15-/m0/s1 |
| InChIKey | DBLTVSGDOHIHTA-HNNXBMFYSA-N |
| XLogP | 6.39 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |