C17H17Cl2NOS — CID 17383296
1-(3,4-dichlorophenyl)-3-(4-ethylsulfanylanilino)propan-1-one (PubChem CID 17383296) has the molecular formula C17H17Cl2NOS and a molecular weight of 354.30 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(4-ethylsulfanylanilino)propan-1-one.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(4-ethylsulfanylanilino)propan-1-one |
|---|---|
| PubChem CID | 17383296 |
| Molecular Formula | C17H17Cl2NOS |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(4-ethylsulfanylanilino)propan-1-one |
| SMILES | CCSc1ccc(NCCC(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H17Cl2NOS/c1-2-22-14-6-4-13(5-7-14)20-10-9-17(21)12-3-8-15(18)16(19)11-12/h3-8,11,20H,2,9-10H2,1H3 |
| InChIKey | RWJYMRIXRBVIJO-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |