C18H13Cl2NO4S — CID 22784722
(E)-4-[4-[2-(3,4-dichlorophenyl)-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 22784722) has the molecular formula C18H13Cl2NO4S and a molecular weight of 410.28 g/mol. Its IUPAC name is (E)-4-[4-[2-(3,4-dichlorophenyl)-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[2-(3,4-dichlorophenyl)-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 22784722 |
| Molecular Formula | C18H13Cl2NO4S |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | (E)-4-[4-[2-(3,4-dichlorophenyl)-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1ccc(SCC(=O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H13Cl2NO4S/c19-14-6-1-11(9-15(14)20)16(22)10-26-13-4-2-12(3-5-13)21-17(23)7-8-18(24)25/h1-9H,10H2,(H,21,23)(H,24,25)/b8-7+ |
| InChIKey | VKWACWOMWYYNEB-BQYQJAHWSA-N |
| XLogP | 4.55 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|