C27H20N2O7S — CID 102267327
(E)-4-[4-[4-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]sulfanylbenzoyl]anilino]-4-oxobut-2-enoic acid (PubChem CID 102267327) has the molecular formula C27H20N2O7S and a molecular weight of 516.53 g/mol. Its IUPAC name is (E)-4-[4-[4-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]sulfanylbenzoyl]anilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[4-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]sulfanylbenzoyl]anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 102267327 |
| Molecular Formula | C27H20N2O7S |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | (E)-4-[4-[4-[4-[[(E)-3-carboxyprop-2-enoyl]amino]phenyl]sulfanylbenzoyl]anilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1ccc(Sc2ccc(C(=O)c3ccc(NC(=O)/C=C/C(=O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H20N2O7S/c30-23(13-15-25(32)33)28-19-5-1-17(2-6-19)27(36)18-3-9-21(10-4-18)37-22-11-7-20(8-12-22)29-24(31)14-16-26(34)35/h1-16H,(H,28,30)(H,29,31)(H,32,33)(H,34,35)/b15-13+,16-14+ |
| InChIKey | WIESNHQSLVVGIR-WXUKJITCSA-N |
| XLogP | 4.23 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|