C11H15ClN2O3S — CID 17385282
(2-chloro-1-methylindol-3-yl)methanamine;methanesulfonic acid (PubChem CID 17385282) has the molecular formula C11H15ClN2O3S and a molecular weight of 290.77 g/mol. Its IUPAC name is (2-chloro-1-methylindol-3-yl)methanamine;methanesulfonic acid.
| Compound Name | (2-chloro-1-methylindol-3-yl)methanamine;methanesulfonic acid |
|---|---|
| PubChem CID | 17385282 |
| Molecular Formula | C11H15ClN2O3S |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | (2-chloro-1-methylindol-3-yl)methanamine;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cn1c(Cl)c(CN)c2ccccc21 |
| InChI | InChI=1S/C10H11ClN2.CH4O3S/c1-13-9-5-3-2-4-7(9)8(6-12)10(13)11;1-5(2,3)4/h2-5H,6,12H2,1H3;1H3,(H,2,3,4) |
| InChIKey | IKUFFBZNQXZRFL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|