C19H22N2O2S — CID 110782446
N-[(1,2-dimethylindol-3-yl)methyl]-1-(2-methylphenyl)methanesulfonamide (PubChem CID 110782446) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is N-[(1,2-dimethylindol-3-yl)methyl]-1-(2-methylphenyl)methanesulfonamide.
| Compound Name | N-[(1,2-dimethylindol-3-yl)methyl]-1-(2-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 110782446 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-[(1,2-dimethylindol-3-yl)methyl]-1-(2-methylphenyl)methanesulfonamide |
| SMILES | Cc1ccccc1CS(=O)(=O)NCc1c(C)n(C)c2ccccc12 |
| InChI | InChI=1S/C19H22N2O2S/c1-14-8-4-5-9-16(14)13-24(22,23)20-12-18-15(2)21(3)19-11-7-6-10-17(18)19/h4-11,20H,12-13H2,1-3H3 |
| InChIKey | YIWQBWJMNIQMHC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|