C17H22N4O2S — CID 110789137
N-[2-(1,2-dimethylindol-3-yl)ethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 110789137) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[2-(1,2-dimethylindol-3-yl)ethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[2-(1,2-dimethylindol-3-yl)ethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 110789137 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[2-(1,2-dimethylindol-3-yl)ethyl]-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NCCc1c(C)n(C)c2ccccc12 |
| InChI | InChI=1S/C17H22N4O2S/c1-11-17(12(2)20-19-11)24(22,23)18-10-9-14-13(3)21(4)16-8-6-5-7-15(14)16/h5-8,18H,9-10H2,1-4H3,(H,19,20) |
| InChIKey | YPJIKUOIONIMKH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|