C20H24N2O3S — CID 113085626
N-[2-(1,2-dimethylindol-3-yl)ethyl]-2-methoxy-5-methylbenzenesulfonamide (PubChem CID 113085626) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-[2-(1,2-dimethylindol-3-yl)ethyl]-2-methoxy-5-methylbenzenesulfonamide.
| Compound Name | N-[2-(1,2-dimethylindol-3-yl)ethyl]-2-methoxy-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113085626 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[2-(1,2-dimethylindol-3-yl)ethyl]-2-methoxy-5-methylbenzenesulfonamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)NCCc1c(C)n(C)c2ccccc12 |
| InChI | InChI=1S/C20H24N2O3S/c1-14-9-10-19(25-4)20(13-14)26(23,24)21-12-11-16-15(2)22(3)18-8-6-5-7-17(16)18/h5-10,13,21H,11-12H2,1-4H3 |
| InChIKey | UPGOSOIBLXOLLL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|