C17H20N2O2S2 — CID 113085634
N-[2-(1,2-dimethylindol-3-yl)ethyl]-5-methylthiophene-2-sulfonamide (PubChem CID 113085634) has the molecular formula C17H20N2O2S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[2-(1,2-dimethylindol-3-yl)ethyl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[2-(1,2-dimethylindol-3-yl)ethyl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113085634 |
| Molecular Formula | C17H20N2O2S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-[2-(1,2-dimethylindol-3-yl)ethyl]-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCc2c(C)n(C)c3ccccc23)s1 |
| InChI | InChI=1S/C17H20N2O2S2/c1-12-8-9-17(22-12)23(20,21)18-11-10-14-13(2)19(3)16-7-5-4-6-15(14)16/h4-9,18H,10-11H2,1-3H3 |
| InChIKey | BPNNXCCZGIZGRB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|