C16H22N2O — CID 110782396
N-[(1,2-dimethylindol-3-yl)methyl]-2,2-dimethylpropanamide (PubChem CID 110782396) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is N-[(1,2-dimethylindol-3-yl)methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(1,2-dimethylindol-3-yl)methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 110782396 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-[(1,2-dimethylindol-3-yl)methyl]-2,2-dimethylpropanamide |
| SMILES | Cc1c(CNC(=O)C(C)(C)C)c2ccccc2n1C |
| InChI | InChI=1S/C16H22N2O/c1-11-13(10-17-15(19)16(2,3)4)12-8-6-7-9-14(12)18(11)5/h6-9H,10H2,1-5H3,(H,17,19) |
| InChIKey | KPLOQCOXIBSYBL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|