C21H30N4O2 — CID 110813029
N-tert-butyl-4-[2-(1,2-dimethylindol-3-yl)acetyl]piperazine-1-carboxamide (PubChem CID 110813029) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-tert-butyl-4-[2-(1,2-dimethylindol-3-yl)acetyl]piperazine-1-carboxamide.
| Compound Name | N-tert-butyl-4-[2-(1,2-dimethylindol-3-yl)acetyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110813029 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N-tert-butyl-4-[2-(1,2-dimethylindol-3-yl)acetyl]piperazine-1-carboxamide |
| SMILES | Cc1c(CC(=O)N2CCN(C(=O)NC(C)(C)C)CC2)c2ccccc2n1C |
| InChI | InChI=1S/C21H30N4O2/c1-15-17(16-8-6-7-9-18(16)23(15)5)14-19(26)24-10-12-25(13-11-24)20(27)22-21(2,3)4/h6-9H,10-14H2,1-5H3,(H,22,27) |
| InChIKey | VDWLHQOKNLFFKO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|