C17H23N3O3S — CID 110804596
2-(1,2-dimethylindol-3-yl)-1-(4-methylsulfonylpiperazin-1-yl)ethanone (PubChem CID 110804596) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 2-(1,2-dimethylindol-3-yl)-1-(4-methylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 2-(1,2-dimethylindol-3-yl)-1-(4-methylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 110804596 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-(1,2-dimethylindol-3-yl)-1-(4-methylsulfonylpiperazin-1-yl)ethanone |
| SMILES | Cc1c(CC(=O)N2CCN(S(C)(=O)=O)CC2)c2ccccc2n1C |
| InChI | InChI=1S/C17H23N3O3S/c1-13-15(14-6-4-5-7-16(14)18(13)2)12-17(21)19-8-10-20(11-9-19)24(3,22)23/h4-7H,8-12H2,1-3H3 |
| InChIKey | ZEBICMCSZVZHKB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|