C21H30N4O2 — CID 110813872
4-[2-(1,2-dimethylindol-3-yl)acetyl]-N-propan-2-yl-1,4-diazepane-1-carboxamide (PubChem CID 110813872) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 4-[2-(1,2-dimethylindol-3-yl)acetyl]-N-propan-2-yl-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[2-(1,2-dimethylindol-3-yl)acetyl]-N-propan-2-yl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 110813872 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 4-[2-(1,2-dimethylindol-3-yl)acetyl]-N-propan-2-yl-1,4-diazepane-1-carboxamide |
| SMILES | Cc1c(CC(=O)N2CCCN(C(=O)NC(C)C)CC2)c2ccccc2n1C |
| InChI | InChI=1S/C21H30N4O2/c1-15(2)22-21(27)25-11-7-10-24(12-13-25)20(26)14-18-16(3)23(4)19-9-6-5-8-17(18)19/h5-6,8-9,15H,7,10-14H2,1-4H3,(H,22,27) |
| InChIKey | DFRFMZQVENKGSG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 57.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|